C11H13N3O3 — CID 151555324
1-isocyanato-1,3-bis(isocyanatomethyl)cyclohexane (PubChem CID 151555324) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 1-isocyanato-1,3-bis(isocyanatomethyl)cyclohexane.
| Compound Name | 1-isocyanato-1,3-bis(isocyanatomethyl)cyclohexane |
|---|---|
| PubChem CID | 151555324 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-isocyanato-1,3-bis(isocyanatomethyl)cyclohexane |
| SMILES | O=C=NCC1CCCC(CN=C=O)(N=C=O)C1 |
| InChI | InChI=1S/C11H13N3O3/c15-7-12-5-10-2-1-3-11(4-10,14-9-17)6-13-8-16/h10H,1-6H2 |
| InChIKey | QBIPGXVPGKMNTN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|