C16H25NO — CID 141162571
5-(cyclohexylmethyl)-5-isocyanato-2,3,3a,4,6,6a-hexahydro-1H-pentalene (PubChem CID 141162571) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-5-isocyanato-2,3,3a,4,6,6a-hexahydro-1H-pentalene.
| Compound Name | 5-(cyclohexylmethyl)-5-isocyanato-2,3,3a,4,6,6a-hexahydro-1H-pentalene |
|---|---|
| PubChem CID | 141162571 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 5-(cyclohexylmethyl)-5-isocyanato-2,3,3a,4,6,6a-hexahydro-1H-pentalene |
| SMILES | O=C=NC1(CC2CCCCC2)CC2CCCC2C1 |
| InChI | InChI=1S/C16H25NO/c18-12-17-16(9-13-5-2-1-3-6-13)10-14-7-4-8-15(14)11-16/h13-15H,1-11H2 |
| InChIKey | PNNAUIMXYJIDDG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|