C19H26O2 — CID 21403436
3-[(4-cyclopropylphenoxy)methyl]-2-methyl-2-(4-methylpent-3-enyl)oxirane (PubChem CID 21403436) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-[(4-cyclopropylphenoxy)methyl]-2-methyl-2-(4-methylpent-3-enyl)oxirane.
| Compound Name | 3-[(4-cyclopropylphenoxy)methyl]-2-methyl-2-(4-methylpent-3-enyl)oxirane |
|---|---|
| PubChem CID | 21403436 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 3-[(4-cyclopropylphenoxy)methyl]-2-methyl-2-(4-methylpent-3-enyl)oxirane |
| SMILES | CC(C)=CCCC1(C)OC1COc1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C19H26O2/c1-14(2)5-4-12-19(3)18(21-19)13-20-17-10-8-16(9-11-17)15-6-7-15/h5,8-11,15,18H,4,6-7,12-13H2,1-3H3 |
| InChIKey | KIOZNNYWKWUBSY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|