C11H20Br2Cl2O — CID 159953844
1-bromo-3-methylbut-2-ene;3-(bromomethyl)-2,2-dimethyloxirane;dichloromethane (PubChem CID 159953844) has the molecular formula C11H20Br2Cl2O and a molecular weight of 398.99 g/mol. Its IUPAC name is 1-bromo-3-methylbut-2-ene;3-(bromomethyl)-2,2-dimethyloxirane;dichloromethane.
| Compound Name | 1-bromo-3-methylbut-2-ene;3-(bromomethyl)-2,2-dimethyloxirane;dichloromethane |
|---|---|
| PubChem CID | 159953844 |
| Molecular Formula | C11H20Br2Cl2O |
| Molecular Weight | 398.99 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | 1-bromo-3-methylbut-2-ene;3-(bromomethyl)-2,2-dimethyloxirane;dichloromethane |
| SMILES | CC(C)=CCBr.CC1(C)OC1CBr.ClCCl |
| InChI | InChI=1S/C5H9BrO.C5H9Br.CH2Cl2/c1-5(2)4(3-6)7-5;1-5(2)3-4-6;2-1-3/h4H,3H2,1-2H3;3H,4H2,1-2H3;1H2 |
| InChIKey | OCLPAIVPIQHGNA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.99 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|