C20H34O4 — CID 163048963
(6S)-9-[(2S,3R)-3-[(E)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-2-methyloxiran-2-yl]-2,6-dimethylnon-2-en-5-one (PubChem CID 163048963) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (6S)-9-[(2S,3R)-3-[(E)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-2-methyloxiran-2-yl]-2,6-dimethylnon-2-en-5-one.
| Compound Name | (6S)-9-[(2S,3R)-3-[(E)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-2-methyloxiran-2-yl]-2,6-dimethylnon-2-en-5-one |
|---|---|
| PubChem CID | 163048963 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (6S)-9-[(2S,3R)-3-[(E)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-2-methyloxiran-2-yl]-2,6-dimethylnon-2-en-5-one |
| SMILES | CC(C)=CCC(=O)[C@@H](C)CCC[C@]1(C)O[C@@H]1CC/C(=C\CO)CO |
| InChI | InChI=1S/C20H34O4/c1-15(2)7-9-18(23)16(3)6-5-12-20(4)19(24-20)10-8-17(14-22)11-13-21/h7,11,16,19,21-22H,5-6,8-10,12-14H2,1-4H3/b17-11+/t16-,19+,20-/m0/s1 |
| InChIKey | HAEAVKBVZVAUFR-JKYRMGHSSA-N |
| XLogP | 3.57 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|