C23H36O6 — CID 70514134
methyl (2E)-2-[(6R,7S)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]acetate (PubChem CID 70514134) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is methyl (2E)-2-[(6R,7S)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(6R,7S)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]acetate |
|---|---|
| PubChem CID | 70514134 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | methyl (2E)-2-[(6R,7S)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CC[C@@H](OC(C)=O)[C@](C)(CCCC(C)C(=O)CC=C(C)C)OC1 |
| InChI | InChI=1S/C23H36O6/c1-16(2)9-11-20(25)17(3)8-7-13-23(5)21(29-18(4)24)12-10-19(15-28-23)14-22(26)27-6/h9,14,17,21H,7-8,10-13,15H2,1-6H3/b19-14+/t17?,21-,23+/m1/s1 |
| InChIKey | QZXYAZBLFSCRRX-SQWCZXGNSA-N |
| XLogP | 4.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|