C24H38O6 — CID 88723820
[(2S,3R,6E)-2-(5-acetyloxy-4,8-dimethylnon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate (PubChem CID 88723820) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is [(2S,3R,6E)-2-(5-acetyloxy-4,8-dimethylnon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate.
| Compound Name | [(2S,3R,6E)-2-(5-acetyloxy-4,8-dimethylnon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate |
|---|---|
| PubChem CID | 88723820 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | [(2S,3R,6E)-2-(5-acetyloxy-4,8-dimethylnon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate |
| SMILES | CC(=O)OC(CC=C(C)C)C(C)CCC[C@]1(C)OC/C(=C/C=O)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H38O6/c1-17(2)9-11-22(29-19(4)26)18(3)8-7-14-24(6)23(30-20(5)27)12-10-21(13-15-25)16-28-24/h9,13,15,18,22-23H,7-8,10-12,14,16H2,1-6H3/b21-13+/t18?,22?,23-,24+/m1/s1 |
| InChIKey | DFWKHLWILHNCNU-YFASDUROSA-N |
| XLogP | 4.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|