C26H42O7 — CID 57064504
2-[(6R,7S)-6-acetyloxy-7-(5-acetyloxy-4,8-dimethylnon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate (PubChem CID 57064504) has the molecular formula C26H42O7 and a molecular weight of 466.62 g/mol. Its IUPAC name is 2-[(6R,7S)-6-acetyloxy-7-(5-acetyloxy-4,8-dimethylnon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate.
| Compound Name | 2-[(6R,7S)-6-acetyloxy-7-(5-acetyloxy-4,8-dimethylnon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate |
|---|---|
| PubChem CID | 57064504 |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 2-[(6R,7S)-6-acetyloxy-7-(5-acetyloxy-4,8-dimethylnon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate |
| SMILES | CC(=O)OCC=C1CC[C@@H](OC(C)=O)[C@](C)(CCCC(C)C(CC=C(C)C)OC(C)=O)OC1 |
| InChI | InChI=1S/C26H42O7/c1-18(2)10-12-24(32-21(5)28)19(3)9-8-15-26(7)25(33-22(6)29)13-11-23(17-31-26)14-16-30-20(4)27/h10,14,19,24-25H,8-9,11-13,15-17H2,1-7H3/t19?,24?,25-,26+/m1/s1 |
| InChIKey | NRPHQUBDJIBXIR-AWLJAHRVSA-N |
| XLogP | 5.07 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|