C16H28O2 — CID 143685491
(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)-2-[5-(2-methyloxiran-2-yl)pentyl]oxirane (PubChem CID 143685491) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (2R,3R)-2-methyl-3-(3-methylbut-2-enyl)-2-[5-(2-methyloxiran-2-yl)pentyl]oxirane.
| Compound Name | (2R,3R)-2-methyl-3-(3-methylbut-2-enyl)-2-[5-(2-methyloxiran-2-yl)pentyl]oxirane |
|---|---|
| PubChem CID | 143685491 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (2R,3R)-2-methyl-3-(3-methylbut-2-enyl)-2-[5-(2-methyloxiran-2-yl)pentyl]oxirane |
| SMILES | CC(C)=CC[C@H]1O[C@]1(C)CCCCCC1(C)CO1 |
| InChI | InChI=1S/C16H28O2/c1-13(2)8-9-14-16(4,18-14)11-7-5-6-10-15(3)12-17-15/h8,14H,5-7,9-12H2,1-4H3/t14-,15?,16-/m1/s1 |
| InChIKey | YBDGEUMCAPIMES-YTPLPTRZSA-N |
| XLogP | 4.24 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|