C30H50O6 — CID 76632402
2,6-dimethyl-9-[2-methyl-3-(oxan-2-yloxy)-4-[2-(oxan-2-yloxy)ethylidene]oxepan-2-yl]non-2-en-5-one (PubChem CID 76632402) has the molecular formula C30H50O6 and a molecular weight of 506.72 g/mol. Its IUPAC name is 2,6-dimethyl-9-[2-methyl-3-(oxan-2-yloxy)-4-[2-(oxan-2-yloxy)ethylidene]oxepan-2-yl]non-2-en-5-one.
| Compound Name | 2,6-dimethyl-9-[2-methyl-3-(oxan-2-yloxy)-4-[2-(oxan-2-yloxy)ethylidene]oxepan-2-yl]non-2-en-5-one |
|---|---|
| PubChem CID | 76632402 |
| Molecular Formula | C30H50O6 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | 2,6-dimethyl-9-[2-methyl-3-(oxan-2-yloxy)-4-[2-(oxan-2-yloxy)ethylidene]oxepan-2-yl]non-2-en-5-one |
| SMILES | CC(C)=CCC(=O)C(C)CCCC1(C)OCCCC(=CCOC2CCCCO2)C1OC1CCCCO1 |
| InChI | InChI=1S/C30H50O6/c1-23(2)15-16-26(31)24(3)11-9-18-30(4)29(36-28-14-6-8-20-33-28)25(12-10-21-35-30)17-22-34-27-13-5-7-19-32-27/h15,17,24,27-29H,5-14,16,18-22H2,1-4H3 |
| InChIKey | AFXNCROHRLFLBT-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|