C15H27NO — CID 23243116
[(2S,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methylaziridin-2-yl]methanol (PubChem CID 23243116) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is [(2S,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methylaziridin-2-yl]methanol.
| Compound Name | [(2S,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methylaziridin-2-yl]methanol |
|---|---|
| PubChem CID | 23243116 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | [(2S,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methylaziridin-2-yl]methanol |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@@]1(C)N[C@@H]1CO |
| InChI | InChI=1S/C15H27NO/c1-12(2)7-5-8-13(3)9-6-10-15(4)14(11-17)16-15/h7,9,14,16-17H,5-6,8,10-11H2,1-4H3/b13-9+/t14-,15-/m1/s1 |
| InChIKey | VKZWAKLSMCEIKO-IVBVFNMWSA-N |
| XLogP | 3.18 |
| TPSA | 42.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|