C29H36O — CID 66866176
4-[6-methyl-6-phenyl-5-(2-phenylpropan-2-yl)heptyl]phenol (PubChem CID 66866176) has the molecular formula C29H36O and a molecular weight of 400.61 g/mol. Its IUPAC name is 4-[6-methyl-6-phenyl-5-(2-phenylpropan-2-yl)heptyl]phenol.
| Compound Name | 4-[6-methyl-6-phenyl-5-(2-phenylpropan-2-yl)heptyl]phenol |
|---|---|
| PubChem CID | 66866176 |
| Molecular Formula | C29H36O |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 4-[6-methyl-6-phenyl-5-(2-phenylpropan-2-yl)heptyl]phenol |
| SMILES | CC(C)(c1ccccc1)C(CCCCc1ccc(O)cc1)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C29H36O/c1-28(2,24-14-7-5-8-15-24)27(29(3,4)25-16-9-6-10-17-25)18-12-11-13-23-19-21-26(30)22-20-23/h5-10,14-17,19-22,27,30H,11-13,18H2,1-4H3 |
| InChIKey | ZYEVKOFAGLGQMP-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|