C19H24O4 — CID 11034432
(3R,5R)-1,7-bis(4-hydroxyphenyl)heptane-3,5-diol (PubChem CID 11034432) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (3R,5R)-1,7-bis(4-hydroxyphenyl)heptane-3,5-diol.
| Compound Name | (3R,5R)-1,7-bis(4-hydroxyphenyl)heptane-3,5-diol |
|---|---|
| PubChem CID | 11034432 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (3R,5R)-1,7-bis(4-hydroxyphenyl)heptane-3,5-diol |
| SMILES | Oc1ccc(CC[C@@H](O)C[C@H](O)CCc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C19H24O4/c20-16-7-1-14(2-8-16)5-11-18(22)13-19(23)12-6-15-3-9-17(21)10-4-15/h1-4,7-10,18-23H,5-6,11-13H2/t18-,19-/m1/s1 |
| InChIKey | GZVIQGVWSNEONZ-RTBURBONSA-N |
| XLogP | 2.78 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |