C19H20O4 — CID 102176225
(E)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-1-en-3-one (PubChem CID 102176225) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (E)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-1-en-3-one.
| Compound Name | (E)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-1-en-3-one |
|---|---|
| PubChem CID | 102176225 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (E)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-1-en-3-one |
| SMILES | O=C(/C=C/c1ccc(O)cc1)CC(O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C19H20O4/c20-16-7-1-14(2-8-16)5-11-18(22)13-19(23)12-6-15-3-9-17(21)10-4-15/h1-5,7-11,19-21,23H,6,12-13H2/b11-5+ |
| InChIKey | CWFOAVBXINFPCW-VZUCSPMQSA-N |
| XLogP | 3.06 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|