C19H18O5 — CID 91307775
3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione (PubChem CID 91307775) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione.
| Compound Name | 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione |
|---|---|
| PubChem CID | 91307775 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione |
| SMILES | O=C(C=Cc1ccc(O)cc1)CC(O)CC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H18O5/c20-15-6-1-13(2-7-15)3-8-17(22)11-18(23)12-19(24)14-4-9-16(21)10-5-14/h1-10,18,20-21,23H,11-12H2 |
| InChIKey | NEZCLOILSKYYSV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|