About 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione
3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione (PubChem CID 91307775) has the molecular formula C19H18O5
and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione.
Molecular Properties
| Compound Name | 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione |
| PubChem CID | 91307775 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione |
| SMILES | O=C(C=Cc1ccc(O)cc1)CC(O)CC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H18O5/c20-15-6-1-13(2-7-15)3-8-17(22)11-18(23)12-19(24)14-4-9-16(21)10-5-14/h1-10,18,20-21,23H,11-12H2 |
| InChIKey | NEZCLOILSKYYSV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione?
The IUPAC name of 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione (CID 91307775) is 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione.
What is the SMILES notation for 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione?
The canonical SMILES for 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione is O=C(C=Cc1ccc(O)cc1)CC(O)CC(=O)c1ccc(O)cc1.
What is the InChIKey of 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione?
The InChIKey is NEZCLOILSKYYSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O5/c20-15-6-1-13(2-7-15)3-8-17(22)11-18(23)12-19(24)14-4-9-16(21)10-5-14/h1-10,18,20-21,23H,11-12H2.
What are the key properties of 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione?
3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione has a molecular weight of 326.35 g/mol, XLogP of 2.70, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1,7-bis(4-hydroxyphenyl)hept-6-ene-1,5-dione is sourced from PubChem (CID 91307775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).