C15H22O6 — CID 75181127
2-[2-hydroxy-4-(4-hydroxyphenyl)butyl]oxane-3,4,5-triol (PubChem CID 75181127) has the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-[2-hydroxy-4-(4-hydroxyphenyl)butyl]oxane-3,4,5-triol.
| Compound Name | 2-[2-hydroxy-4-(4-hydroxyphenyl)butyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 75181127 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[2-hydroxy-4-(4-hydroxyphenyl)butyl]oxane-3,4,5-triol |
| SMILES | Oc1ccc(CCC(O)CC2OCC(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C15H22O6/c16-10-4-1-9(2-5-10)3-6-11(17)7-13-15(20)14(19)12(18)8-21-13/h1-2,4-5,11-20H,3,6-8H2 |
| InChIKey | RWEZQYLNFIVBNA-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |