C16H25NO5 — CID 123753142
2-[2-(methoxyamino)-4-phenylbutyl]oxane-3,4,5-triol (PubChem CID 123753142) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[2-(methoxyamino)-4-phenylbutyl]oxane-3,4,5-triol.
| Compound Name | 2-[2-(methoxyamino)-4-phenylbutyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 123753142 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-[2-(methoxyamino)-4-phenylbutyl]oxane-3,4,5-triol |
| SMILES | CONC(CCc1ccccc1)CC1OCC(O)C(O)C1O |
| InChI | InChI=1S/C16H25NO5/c1-21-17-12(8-7-11-5-3-2-4-6-11)9-14-16(20)15(19)13(18)10-22-14/h2-6,12-20H,7-10H2,1H3 |
| InChIKey | GKVYNCAJIXKURZ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|