C14H21NO7 — CID 5288396
4-[(1S)-1-hydroxy-2-iminoethyl]phenol;(2R,3S,4R,5S)-2-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 5288396) has the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. Its IUPAC name is 4-[(1S)-1-hydroxy-2-iminoethyl]phenol;(2R,3S,4R,5S)-2-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 4-[(1S)-1-hydroxy-2-iminoethyl]phenol;(2R,3S,4R,5S)-2-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 5288396 |
| Molecular Formula | C14H21NO7 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4-[(1S)-1-hydroxy-2-iminoethyl]phenol;(2R,3S,4R,5S)-2-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1OC[C@H](O)[C@@H](O)[C@@H]1O.[H]/N=C/[C@@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H9NO2.C6H12O5/c9-5-8(11)6-1-3-7(10)4-2-6;7-1-4-6(10)5(9)3(8)2-11-4/h1-5,8-11H;3-10H,1-2H2/b9-5+;/t8-;3-,4+,5+,6+/m10/s1 |
| InChIKey | FAPLPVVVTPONFC-ZTIKSFNGSA-N |
| XLogP | -1.46 |
| TPSA | 154.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|