C19H20O5 — CID 162989758
[(2S,3R)-3-[(2R)-2-hydroxy-4-(4-hydroxyphenyl)butyl]oxiran-2-yl]-(4-hydroxyphenyl)methanone (PubChem CID 162989758) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is [(2S,3R)-3-[(2R)-2-hydroxy-4-(4-hydroxyphenyl)butyl]oxiran-2-yl]-(4-hydroxyphenyl)methanone.
| Compound Name | [(2S,3R)-3-[(2R)-2-hydroxy-4-(4-hydroxyphenyl)butyl]oxiran-2-yl]-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 162989758 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(2S,3R)-3-[(2R)-2-hydroxy-4-(4-hydroxyphenyl)butyl]oxiran-2-yl]-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)[C@H]1O[C@@H]1C[C@H](O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C19H20O5/c20-14-6-1-12(2-7-14)3-8-16(22)11-17-19(24-17)18(23)13-4-9-15(21)10-5-13/h1-2,4-7,9-10,16-17,19-22H,3,8,11H2/t16-,17-,19+/m1/s1 |
| InChIKey | SFLXZEYRHVXOSA-LMMKCTJWSA-N |
| XLogP | 2.43 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|