C15H24O3 — CID 71094748
(5R)-1-(4-hydroxyphenyl)-5-methyloctane-3,5-diol (PubChem CID 71094748) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (5R)-1-(4-hydroxyphenyl)-5-methyloctane-3,5-diol.
| Compound Name | (5R)-1-(4-hydroxyphenyl)-5-methyloctane-3,5-diol |
|---|---|
| PubChem CID | 71094748 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (5R)-1-(4-hydroxyphenyl)-5-methyloctane-3,5-diol |
| SMILES | CCC[C@@](C)(O)CC(O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C15H24O3/c1-3-10-15(2,18)11-14(17)9-6-12-4-7-13(16)8-5-12/h4-5,7-8,14,16-18H,3,6,9-11H2,1-2H3/t14?,15-/m1/s1 |
| InChIKey | UMUQGWPAQHYMOM-YSSOQSIOSA-N |
| XLogP | 2.63 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |