C15H23Br — CID 83141914
[4-(bromomethyl)-5,5-dimethylhexyl]benzene (PubChem CID 83141914) has the molecular formula C15H23Br and a molecular weight of 283.25 g/mol. Its IUPAC name is [4-(bromomethyl)-5,5-dimethylhexyl]benzene.
| Compound Name | [4-(bromomethyl)-5,5-dimethylhexyl]benzene |
|---|---|
| PubChem CID | 83141914 |
| Molecular Formula | C15H23Br |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | [4-(bromomethyl)-5,5-dimethylhexyl]benzene |
| SMILES | CC(C)(C)C(CBr)CCCc1ccccc1 |
| InChI | InChI=1S/C15H23Br/c1-15(2,3)14(12-16)11-7-10-13-8-5-4-6-9-13/h4-6,8-9,14H,7,10-12H2,1-3H3 |
| InChIKey | NDCBXZWQFCUIID-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|