C15H18O — CID 102383494
(E)-6,6-dimethyl-1-phenylhept-1-en-4-yn-3-ol (PubChem CID 102383494) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (E)-6,6-dimethyl-1-phenylhept-1-en-4-yn-3-ol.
| Compound Name | (E)-6,6-dimethyl-1-phenylhept-1-en-4-yn-3-ol |
|---|---|
| PubChem CID | 102383494 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (E)-6,6-dimethyl-1-phenylhept-1-en-4-yn-3-ol |
| SMILES | CC(C)(C)C#CC(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H18O/c1-15(2,3)12-11-14(16)10-9-13-7-5-4-6-8-13/h4-10,14,16H,1-3H3/b10-9+ |
| InChIKey | CDWZZRDGYWYLMC-MDZDMXLPSA-N |
| XLogP | 3.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|