C22H24 — CID 101011703
[(Z)-2,7-dimethyl-7-phenyloct-3-en-5-yn-2-yl]benzene (PubChem CID 101011703) has the molecular formula C22H24 and a molecular weight of 288.43 g/mol. Its IUPAC name is [(Z)-2,7-dimethyl-7-phenyloct-3-en-5-yn-2-yl]benzene.
| Compound Name | [(Z)-2,7-dimethyl-7-phenyloct-3-en-5-yn-2-yl]benzene |
|---|---|
| PubChem CID | 101011703 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | [(Z)-2,7-dimethyl-7-phenyloct-3-en-5-yn-2-yl]benzene |
| SMILES | CC(C)(C#C/C=C\C(C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24/c1-21(2,19-13-7-5-8-14-19)17-11-12-18-22(3,4)20-15-9-6-10-16-20/h5-11,13-17H,1-4H3/b17-11- |
| InChIKey | XKZFEMPHUXZDFM-BOPFTXTBSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|