C20H22 — CID 166095951
(3,4-dimethyl-4-phenylhexa-1,5-dien-3-yl)benzene (PubChem CID 166095951) has the molecular formula C20H22 and a molecular weight of 262.40 g/mol. Its IUPAC name is (3,4-dimethyl-4-phenylhexa-1,5-dien-3-yl)benzene.
| Compound Name | (3,4-dimethyl-4-phenylhexa-1,5-dien-3-yl)benzene |
|---|---|
| PubChem CID | 166095951 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (3,4-dimethyl-4-phenylhexa-1,5-dien-3-yl)benzene |
| SMILES | C=CC(C)(c1ccccc1)C(C)(C=C)c1ccccc1 |
| InChI | InChI=1S/C20H22/c1-5-19(3,17-13-9-7-10-14-17)20(4,6-2)18-15-11-8-12-16-18/h5-16H,1-2H2,3-4H3 |
| InChIKey | OYPULXQJYVOQBQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|