C26H26O2 — CID 22935837
1,4-bis(1-ethenoxy-1-phenylethyl)benzene (PubChem CID 22935837) has the molecular formula C26H26O2 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1,4-bis(1-ethenoxy-1-phenylethyl)benzene.
| Compound Name | 1,4-bis(1-ethenoxy-1-phenylethyl)benzene |
|---|---|
| PubChem CID | 22935837 |
| Molecular Formula | C26H26O2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1,4-bis(1-ethenoxy-1-phenylethyl)benzene |
| SMILES | C=COC(C)(c1ccccc1)c1ccc(C(C)(OC=C)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26O2/c1-5-27-25(3,21-13-9-7-10-14-21)23-17-19-24(20-18-23)26(4,28-6-2)22-15-11-8-12-16-22/h5-20H,1-2H2,3-4H3 |
| InChIKey | NDDISBQLBUSTRD-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|