C11H8Cl2N2S — CID 166735111
N-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenyl]aniline (PubChem CID 166735111) has the molecular formula C11H8Cl2N2S and a molecular weight of 271.17 g/mol. Its IUPAC name is N-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenyl]aniline.
| Compound Name | N-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 166735111 |
| Molecular Formula | C11H8Cl2N2S |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | N-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenyl]aniline |
| SMILES | C=C(Nc1ccccc1)c1snc(Cl)c1Cl |
| InChI | InChI=1S/C11H8Cl2N2S/c1-7(10-9(12)11(13)15-16-10)14-8-5-3-2-4-6-8/h2-6,14H,1H2 |
| InChIKey | RRCOVBIYIPTDDC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |