About 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide
3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide (PubChem CID 148585686) has the molecular formula C10H7Cl2N3S
and a molecular weight of 272.16 g/mol. Its IUPAC name is 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide.
Molecular Properties
| Compound Name | 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide |
| PubChem CID | 148585686 |
| Molecular Formula | C10H7Cl2N3S |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide |
| SMILES | N/C(=N\c1ccccc1)c1snc(Cl)c1Cl |
| InChI | InChI=1S/C10H7Cl2N3S/c11-7-8(16-15-9(7)12)10(13)14-6-4-2-1-3-5-6/h1-5H,(H2,13,14) |
| InChIKey | MZQGUCLLOFSYTP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide?
The IUPAC name of 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide (CID 148585686) is 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide.
What is the SMILES notation for 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide?
The canonical SMILES for 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide is N/C(=N\c1ccccc1)c1snc(Cl)c1Cl.
What is the InChIKey of 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide?
The InChIKey is MZQGUCLLOFSYTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2N3S/c11-7-8(16-15-9(7)12)10(13)14-6-4-2-1-3-5-6/h1-5H,(H2,13,14).
What are the key properties of 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide?
3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide has a molecular weight of 272.16 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-N'-phenyl-1,2-thiazole-5-carboximidamide is sourced from PubChem (CID 148585686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).