C10H6Cl2N2OS — CID 19880776
3,4-dichloro-N-phenyl-1,2-thiazole-5-carboxamide (PubChem CID 19880776) has the molecular formula C10H6Cl2N2OS and a molecular weight of 273.14 g/mol. Its IUPAC name is 3,4-dichloro-N-phenyl-1,2-thiazole-5-carboxamide.
| Compound Name | 3,4-dichloro-N-phenyl-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 19880776 |
| Molecular Formula | C10H6Cl2N2OS |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 3,4-dichloro-N-phenyl-1,2-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1snc(Cl)c1Cl |
| InChI | InChI=1S/C10H6Cl2N2OS/c11-7-8(16-14-9(7)12)10(15)13-6-4-2-1-3-5-6/h1-5H,(H,13,15) |
| InChIKey | OMQCRMYQYIGIQI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |