C10H5Cl2FN2OS — CID 750407
4,5-dichloro-N-(4-fluorophenyl)-1,2-thiazole-3-carboxamide (PubChem CID 750407) has the molecular formula C10H5Cl2FN2OS and a molecular weight of 291.13 g/mol. Its IUPAC name is 4,5-dichloro-N-(4-fluorophenyl)-1,2-thiazole-3-carboxamide.
| Compound Name | 4,5-dichloro-N-(4-fluorophenyl)-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 750407 |
| Molecular Formula | C10H5Cl2FN2OS |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 289.95 |
| IUPAC Name | 4,5-dichloro-N-(4-fluorophenyl)-1,2-thiazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1nsc(Cl)c1Cl |
| InChI | InChI=1S/C10H5Cl2FN2OS/c11-7-8(15-17-9(7)12)10(16)14-6-3-1-5(13)2-4-6/h1-4H,(H,14,16) |
| InChIKey | GNZYHWLPACASRA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |