C10H8ClNOS — CID 90418369
(3-chloro-5-phenyl-1,2-thiazol-4-yl)methanol (PubChem CID 90418369) has the molecular formula C10H8ClNOS and a molecular weight of 225.70 g/mol. Its IUPAC name is (3-chloro-5-phenyl-1,2-thiazol-4-yl)methanol.
| Compound Name | (3-chloro-5-phenyl-1,2-thiazol-4-yl)methanol |
|---|---|
| PubChem CID | 90418369 |
| Molecular Formula | C10H8ClNOS |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.00 |
| IUPAC Name | (3-chloro-5-phenyl-1,2-thiazol-4-yl)methanol |
| SMILES | OCc1c(Cl)nsc1-c1ccccc1 |
| InChI | InChI=1S/C10H8ClNOS/c11-10-8(6-13)9(14-12-10)7-4-2-1-3-5-7/h1-5,13H,6H2 |
| InChIKey | PHWIWIVZRPEBRI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |