C29H18N4OS — CID 44604731
4-methoxy-6,12,13-triphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-5-carbonitrile (PubChem CID 44604731) has the molecular formula C29H18N4OS and a molecular weight of 470.56 g/mol. Its IUPAC name is 4-methoxy-6,12,13-triphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-5-carbonitrile.
| Compound Name | 4-methoxy-6,12,13-triphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-5-carbonitrile |
|---|---|
| PubChem CID | 44604731 |
| Molecular Formula | C29H18N4OS |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 4-methoxy-6,12,13-triphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-5-carbonitrile |
| SMILES | COc1nc2c(sc3nnc(-c4ccccc4)c(-c4ccccc4)c32)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C29H18N4OS/c1-34-28-21(17-30)22(18-11-5-2-6-12-18)27-26(31-28)24-23(19-13-7-3-8-14-19)25(32-33-29(24)35-27)20-15-9-4-10-16-20/h2-16H,1H3 |
| InChIKey | KXZMZVDFRPZFDO-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |