C29H17BrN4S — CID 3111144
4-amino-6-(4-bromophenyl)-11,13-diphenyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carbonitrile (PubChem CID 3111144) has the molecular formula C29H17BrN4S and a molecular weight of 533.45 g/mol. Its IUPAC name is 4-amino-6-(4-bromophenyl)-11,13-diphenyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carbonitrile.
| Compound Name | 4-amino-6-(4-bromophenyl)-11,13-diphenyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carbonitrile |
|---|---|
| PubChem CID | 3111144 |
| Molecular Formula | C29H17BrN4S |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 4-amino-6-(4-bromophenyl)-11,13-diphenyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carbonitrile |
| SMILES | N#Cc1c(N)nc2c(sc3nc(-c4ccccc4)cc(-c4ccccc4)c32)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C29H17BrN4S/c30-20-13-11-19(12-14-20)24-22(16-31)28(32)34-26-25-21(17-7-3-1-4-8-17)15-23(18-9-5-2-6-10-18)33-29(25)35-27(24)26/h1-15H,(H2,32,34) |
| InChIKey | VJMWGDPQBOKGOR-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |