C16H11ClN4 — CID 100988453
7-amino-5-chloro-4-methyl-2-phenyl-1,6-naphthyridine-8-carbonitrile (PubChem CID 100988453) has the molecular formula C16H11ClN4 and a molecular weight of 294.75 g/mol. Its IUPAC name is 7-amino-5-chloro-4-methyl-2-phenyl-1,6-naphthyridine-8-carbonitrile.
| Compound Name | 7-amino-5-chloro-4-methyl-2-phenyl-1,6-naphthyridine-8-carbonitrile |
|---|---|
| PubChem CID | 100988453 |
| Molecular Formula | C16H11ClN4 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 7-amino-5-chloro-4-methyl-2-phenyl-1,6-naphthyridine-8-carbonitrile |
| SMILES | Cc1cc(-c2ccccc2)nc2c(C#N)c(N)nc(Cl)c12 |
| InChI | InChI=1S/C16H11ClN4/c1-9-7-12(10-5-3-2-4-6-10)20-14-11(8-18)16(19)21-15(17)13(9)14/h2-7H,1H3,(H2,19,21) |
| InChIKey | ZPMOEWAFKSPFPW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|