C41H28N6O2S2 — CID 44605143
4-[(5-cyano-6,12,13-triphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-yl)amino]-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 44605143) has the molecular formula C41H28N6O2S2 and a molecular weight of 700.85 g/mol. Its IUPAC name is 4-[(5-cyano-6,12,13-triphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-yl)amino]-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | 4-[(5-cyano-6,12,13-triphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-yl)amino]-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 44605143 |
| Molecular Formula | C41H28N6O2S2 |
| Molecular Weight | 700.85 g/mol |
| Exact Mass | 700.17 |
| IUPAC Name | 4-[(5-cyano-6,12,13-triphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-yl)amino]-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(Nc3nc4c(sc5nnc(-c6ccccc6)c(-c6ccccc6)c54)c(-c4ccccc4)c3C#N)cc2)cc1 |
| InChI | InChI=1S/C41H28N6O2S2/c1-26-17-19-31(20-18-26)47-51(48,49)32-23-21-30(22-24-32)43-40-33(25-42)34(27-11-5-2-6-12-27)39-38(44-40)36-35(28-13-7-3-8-14-28)37(45-46-41(36)50-39)29-15-9-4-10-16-29/h2-24,47H,1H3,(H,43,44) |
| InChIKey | WDCMYSACMDZKKK-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.85 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |