C40H25N7O4S2 — CID 44605331
4-[(5-cyano-6,12,13-triphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-yl)amino]-N-(4-nitrophenyl)benzenesulfonamide (PubChem CID 44605331) has the molecular formula C40H25N7O4S2 and a molecular weight of 731.82 g/mol. Its IUPAC name is 4-[(5-cyano-6,12,13-triphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-yl)amino]-N-(4-nitrophenyl)benzenesulfonamide.
| Compound Name | 4-[(5-cyano-6,12,13-triphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-yl)amino]-N-(4-nitrophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 44605331 |
| Molecular Formula | C40H25N7O4S2 |
| Molecular Weight | 731.82 g/mol |
| Exact Mass | 731.14 |
| IUPAC Name | 4-[(5-cyano-6,12,13-triphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-yl)amino]-N-(4-nitrophenyl)benzenesulfonamide |
| SMILES | N#Cc1c(Nc2ccc(S(=O)(=O)Nc3ccc([N+](=O)[O-])cc3)cc2)nc2c(sc3nnc(-c4ccccc4)c(-c4ccccc4)c32)c1-c1ccccc1 |
| InChI | InChI=1S/C40H25N7O4S2/c41-24-32-33(25-10-4-1-5-11-25)38-37(35-34(26-12-6-2-7-13-26)36(44-45-40(35)52-38)27-14-8-3-9-15-27)43-39(32)42-28-18-22-31(23-19-28)53(50,51)46-29-16-20-30(21-17-29)47(48)49/h1-23,46H,(H,42,43) |
| InChIKey | FZMMKPHOYONVGD-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 163.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.82 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|