C19H15N7O6S — CID 71539985
2-[4-[4-[(4-nitrophenyl)sulfonylamino]anilino]pyrazolo[3,4-d]pyrimidin-1-yl]acetic acid (PubChem CID 71539985) has the molecular formula C19H15N7O6S and a molecular weight of 469.44 g/mol. Its IUPAC name is 2-[4-[4-[(4-nitrophenyl)sulfonylamino]anilino]pyrazolo[3,4-d]pyrimidin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-[(4-nitrophenyl)sulfonylamino]anilino]pyrazolo[3,4-d]pyrimidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 71539985 |
| Molecular Formula | C19H15N7O6S |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 2-[4-[4-[(4-nitrophenyl)sulfonylamino]anilino]pyrazolo[3,4-d]pyrimidin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ncc2c(Nc3ccc(NS(=O)(=O)c4ccc([N+](=O)[O-])cc4)cc3)ncnc21 |
| InChI | InChI=1S/C19H15N7O6S/c27-17(28)10-25-19-16(9-22-25)18(20-11-21-19)23-12-1-3-13(4-2-12)24-33(31,32)15-7-5-14(6-8-15)26(29)30/h1-9,11,24H,10H2,(H,27,28)(H,20,21,23) |
| InChIKey | WQKBYTOXUYNRIJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 182.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|