C13H11N5O2 — CID 693338
4-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]benzoic acid (PubChem CID 693338) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 4-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]benzoic acid.
| Compound Name | 4-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 693338 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]benzoic acid |
| SMILES | Cn1ncc2c(Nc3ccc(C(=O)O)cc3)ncnc21 |
| InChI | InChI=1S/C13H11N5O2/c1-18-12-10(6-16-18)11(14-7-15-12)17-9-4-2-8(3-5-9)13(19)20/h2-7H,1H3,(H,19,20)(H,14,15,17) |
| InChIKey | KTMOOROIUKZURU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |