C13H10N6 — CID 110875226
4-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]benzonitrile (PubChem CID 110875226) has the molecular formula C13H10N6 and a molecular weight of 250.27 g/mol. Its IUPAC name is 4-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]benzonitrile.
| Compound Name | 4-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 110875226 |
| Molecular Formula | C13H10N6 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]benzonitrile |
| SMILES | Cn1ncc2c(Nc3ccc(C#N)cc3)ncnc21 |
| InChI | InChI=1S/C13H10N6/c1-19-13-11(7-17-19)12(15-8-16-13)18-10-4-2-9(6-14)3-5-10/h2-5,7-8H,1H3,(H,15,16,18) |
| InChIKey | JTSQRYWZNBWYSQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |