C11H8N6O2 — CID 91407901
N-(4-nitrophenyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 91407901) has the molecular formula C11H8N6O2 and a molecular weight of 256.23 g/mol. Its IUPAC name is N-(4-nitrophenyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine.
| Compound Name | N-(4-nitrophenyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91407901 |
| Molecular Formula | C11H8N6O2 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-(4-nitrophenyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2ncnc3[nH]ncc23)cc1 |
| InChI | InChI=1S/C11H8N6O2/c18-17(19)8-3-1-7(2-4-8)15-10-9-5-14-16-11(9)13-6-12-10/h1-6H,(H2,12,13,14,15,16) |
| InChIKey | RNVFDSUZGWCHKE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|