C16H11N5O2S — CID 146674109
4-N-(8-nitro-[1]benzothiolo[3,2-d]pyrimidin-4-yl)benzene-1,4-diamine (PubChem CID 146674109) has the molecular formula C16H11N5O2S and a molecular weight of 337.36 g/mol. Its IUPAC name is 4-N-(8-nitro-[1]benzothiolo[3,2-d]pyrimidin-4-yl)benzene-1,4-diamine.
| Compound Name | 4-N-(8-nitro-[1]benzothiolo[3,2-d]pyrimidin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 146674109 |
| Molecular Formula | C16H11N5O2S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 4-N-(8-nitro-[1]benzothiolo[3,2-d]pyrimidin-4-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ncnc3c2sc2ccc([N+](=O)[O-])cc23)cc1 |
| InChI | InChI=1S/C16H11N5O2S/c17-9-1-3-10(4-2-9)20-16-15-14(18-8-19-16)12-7-11(21(22)23)5-6-13(12)24-15/h1-8H,17H2,(H,18,19,20) |
| InChIKey | XWSGQXROPVLEKE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|