C21H16N6O3 — CID 71470924
N-(2-aminophenyl)-4-[(6-nitroquinazolin-4-yl)amino]benzamide (PubChem CID 71470924) has the molecular formula C21H16N6O3 and a molecular weight of 400.40 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(6-nitroquinazolin-4-yl)amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(6-nitroquinazolin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 71470924 |
| Molecular Formula | C21H16N6O3 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-(2-aminophenyl)-4-[(6-nitroquinazolin-4-yl)amino]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(Nc2ncnc3ccc([N+](=O)[O-])cc23)cc1 |
| InChI | InChI=1S/C21H16N6O3/c22-17-3-1-2-4-19(17)26-21(28)13-5-7-14(8-6-13)25-20-16-11-15(27(29)30)9-10-18(16)23-12-24-20/h1-12H,22H2,(H,26,28)(H,23,24,25) |
| InChIKey | MOMUCKAYAKKZET-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|