C30H25N5OS — CID 15309709
4-(diethylamino)-5,12,13-triphenyl-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 15309709) has the molecular formula C30H25N5OS and a molecular weight of 503.63 g/mol. Its IUPAC name is 4-(diethylamino)-5,12,13-triphenyl-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 4-(diethylamino)-5,12,13-triphenyl-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 15309709 |
| Molecular Formula | C30H25N5OS |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 4-(diethylamino)-5,12,13-triphenyl-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | CCN(CC)c1nc2c(sc3nnc(-c4ccccc4)c(-c4ccccc4)c32)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C30H25N5OS/c1-3-34(4-2)30-31-26-24-23(20-14-8-5-9-15-20)25(21-16-10-6-11-17-21)32-33-28(24)37-27(26)29(36)35(30)22-18-12-7-13-19-22/h5-19H,3-4H2,1-2H3 |
| InChIKey | JNISNQAPNZMMIA-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |