C18H13N5O — CID 135837392
7-amino-3,4-diphenyl-6H-pyrimido[4,5-c]pyridazin-5-one (PubChem CID 135837392) has the molecular formula C18H13N5O and a molecular weight of 315.34 g/mol. Its IUPAC name is 7-amino-3,4-diphenyl-6H-pyrimido[4,5-c]pyridazin-5-one.
| Compound Name | 7-amino-3,4-diphenyl-6H-pyrimido[4,5-c]pyridazin-5-one |
|---|---|
| PubChem CID | 135837392 |
| Molecular Formula | C18H13N5O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 7-amino-3,4-diphenyl-6H-pyrimido[4,5-c]pyridazin-5-one |
| SMILES | Nc1nc2nnc(-c3ccccc3)c(-c3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C18H13N5O/c19-18-20-16-14(17(24)21-18)13(11-7-3-1-4-8-11)15(22-23-16)12-9-5-2-6-10-12/h1-10H,(H3,19,20,21,23,24) |
| InChIKey | KZYNLFNNKDTMEU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |