C24H20N4O3 — CID 135659171
2-amino-5-(4-phenylmethoxyphenyl)-3,7,8,9-tetrahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135659171) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-amino-5-(4-phenylmethoxyphenyl)-3,7,8,9-tetrahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 2-amino-5-(4-phenylmethoxyphenyl)-3,7,8,9-tetrahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135659171 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-amino-5-(4-phenylmethoxyphenyl)-3,7,8,9-tetrahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | Nc1nc2nc3c(c(-c4ccc(OCc5ccccc5)cc4)c2c(=O)[nH]1)C(=O)CCC3 |
| InChI | InChI=1S/C24H20N4O3/c25-24-27-22-21(23(30)28-24)19(20-17(26-22)7-4-8-18(20)29)15-9-11-16(12-10-15)31-13-14-5-2-1-3-6-14/h1-3,5-6,9-12H,4,7-8,13H2,(H3,25,26,27,28,30) |
| InChIKey | DAOYUWFYQVHULR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |