C23H24N4O2 — CID 135659204
5-(2-methylphenyl)-2-piperidin-1-yl-3,7,8,9-tetrahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135659204) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 5-(2-methylphenyl)-2-piperidin-1-yl-3,7,8,9-tetrahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-(2-methylphenyl)-2-piperidin-1-yl-3,7,8,9-tetrahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135659204 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 5-(2-methylphenyl)-2-piperidin-1-yl-3,7,8,9-tetrahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | Cc1ccccc1-c1c2c(nc3nc(N4CCCCC4)[nH]c(=O)c13)CCCC2=O |
| InChI | InChI=1S/C23H24N4O2/c1-14-8-3-4-9-15(14)18-19-16(10-7-11-17(19)28)24-21-20(18)22(29)26-23(25-21)27-12-5-2-6-13-27/h3-4,8-9H,2,5-7,10-13H2,1H3,(H,24,25,26,29) |
| InChIKey | WMSVFCSQXPRXEB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |