C18H18N4O — CID 135873029
5-phenyl-2-piperidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 135873029) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 5-phenyl-2-piperidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 5-phenyl-2-piperidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135873029 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 5-phenyl-2-piperidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(N2CCCCC2)nc2nccc(-c3ccccc3)c12 |
| InChI | InChI=1S/C18H18N4O/c23-17-15-14(13-7-3-1-4-8-13)9-10-19-16(15)20-18(21-17)22-11-5-2-6-12-22/h1,3-4,7-10H,2,5-6,11-12H2,(H,19,20,21,23) |
| InChIKey | JYYYZJGVMQPJCW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |