C21H22N4O3 — CID 135904353
[4-[2-(4-methylpiperidin-1-yl)-4-oxo-3H-pyrido[2,3-d]pyrimidin-5-yl]phenyl] acetate (PubChem CID 135904353) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is [4-[2-(4-methylpiperidin-1-yl)-4-oxo-3H-pyrido[2,3-d]pyrimidin-5-yl]phenyl] acetate.
| Compound Name | [4-[2-(4-methylpiperidin-1-yl)-4-oxo-3H-pyrido[2,3-d]pyrimidin-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 135904353 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [4-[2-(4-methylpiperidin-1-yl)-4-oxo-3H-pyrido[2,3-d]pyrimidin-5-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2ccnc3nc(N4CCC(C)CC4)[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C21H22N4O3/c1-13-8-11-25(12-9-13)21-23-19-18(20(27)24-21)17(7-10-22-19)15-3-5-16(6-4-15)28-14(2)26/h3-7,10,13H,8-9,11-12H2,1-2H3,(H,22,23,24,27) |
| InChIKey | QJQYYPVMTGZKEV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|