C28H26N4O3 — CID 135874740
6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-(4-methoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,6,8,11,13,15-heptaene-4,17-dione (PubChem CID 135874740) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is 6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-(4-methoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,6,8,11,13,15-heptaene-4,17-dione.
| Compound Name | 6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-(4-methoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,6,8,11,13,15-heptaene-4,17-dione |
|---|---|
| PubChem CID | 135874740 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-(4-methoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,6,8,11,13,15-heptaene-4,17-dione |
| SMILES | COc1ccc(-c2c3c(nc4nc(N5C[C@H](C)C[C@@H](C)C5)[nH]c(=O)c24)-c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C28H26N4O3/c1-15-12-16(2)14-32(13-15)28-30-26-23(27(34)31-28)21(17-8-10-18(35-3)11-9-17)22-24(29-26)19-6-4-5-7-20(19)25(22)33/h4-11,15-16H,12-14H2,1-3H3,(H,29,30,31,34)/t15-,16-/m1/s1 |
| InChIKey | IZHTWDJPXMEEKJ-HZPDHXFCSA-N |
| XLogP | 4.69 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|