C24H20N4O4 — CID 135894972
[4-(2-morpholin-4-yl-4-oxo-3H-pyrido[2,3-d]pyrimidin-5-yl)phenyl] benzoate (PubChem CID 135894972) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is [4-(2-morpholin-4-yl-4-oxo-3H-pyrido[2,3-d]pyrimidin-5-yl)phenyl] benzoate.
| Compound Name | [4-(2-morpholin-4-yl-4-oxo-3H-pyrido[2,3-d]pyrimidin-5-yl)phenyl] benzoate |
|---|---|
| PubChem CID | 135894972 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [4-(2-morpholin-4-yl-4-oxo-3H-pyrido[2,3-d]pyrimidin-5-yl)phenyl] benzoate |
| SMILES | O=C(Oc1ccc(-c2ccnc3nc(N4CCOCC4)[nH]c(=O)c23)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H20N4O4/c29-22-20-19(10-11-25-21(20)26-24(27-22)28-12-14-31-15-13-28)16-6-8-18(9-7-16)32-23(30)17-4-2-1-3-5-17/h1-11H,12-15H2,(H,25,26,27,29) |
| InChIKey | SMIYQSIVIWSTIW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|