C24H22N4O — CID 135659156
5-(4-phenylphenyl)-2-piperidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 135659156) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is 5-(4-phenylphenyl)-2-piperidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(4-phenylphenyl)-2-piperidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135659156 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 5-(4-phenylphenyl)-2-piperidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(N2CCCCC2)nc2nccc(-c3ccc(-c4ccccc4)cc3)c12 |
| InChI | InChI=1S/C24H22N4O/c29-23-21-20(19-11-9-18(10-12-19)17-7-3-1-4-8-17)13-14-25-22(21)26-24(27-23)28-15-5-2-6-16-28/h1,3-4,7-14H,2,5-6,15-16H2,(H,25,26,27,29) |
| InChIKey | WOBYRNBNEJXKLZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |